|
CAS#: 3314-45-2 Product: 3-(4-Biphenylyl)-1-Phenyl-4,5-Dihydro-1H-Pyrazole No suppilers available for the product. |
| Name | 3-(4-Biphenylyl)-1-Phenyl-4,5-Dihydro-1H-Pyrazole |
|---|---|
| Synonyms | 3-[1,1'-Biphenyl]-4-yl-1-phenyl-4,5-dihydro-1H-pyrazole # |
| Molecular Structure | ![]() |
| Molecular Formula | C21H18N2 |
| Molecular Weight | 298.38 |
| CAS Registry Number | 3314-45-2 |
| SMILES | N\3=C(/c2ccc(c1ccccc1)cc2)CCN/3c4ccccc4 |
| InChI | 1S/C21H18N2/c1-3-7-17(8-4-1)18-11-13-19(14-12-18)21-15-16-23(22-21)20-9-5-2-6-10-20/h1-14H,15-16H2 |
| InChIKey | UMRDYXDMHIWPEW-UHFFFAOYSA-N |
| Density | 1.097g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.102°C at 760 mmHg (Cal.) |
| Flash point | 230.247°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Biphenylyl)-1-Phenyl-4,5-Dihydro-1H-Pyrazole |