|
CAS#: 33192-83-5 Product: 3-Ethyl-6-Methyl-2-Phenyl-4(3H)-Pyrimidinone No suppilers available for the product. |
| Name | 3-Ethyl-6-Methyl-2-Phenyl-4(3H)-Pyrimidinone |
|---|---|
| Synonyms | 3-Ethyl-6-methyl-2-phenyl-4(3H)-pyrimidinone # |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.26 |
| CAS Registry Number | 33192-83-5 |
| SMILES | O=C2/C=C(\N=C(\c1ccccc1)N2CC)C |
| InChI | 1S/C13H14N2O/c1-3-15-12(16)9-10(2)14-13(15)11-7-5-4-6-8-11/h4-9H,3H2,1-2H3 |
| InChIKey | AYBSPLONJHJIGM-UHFFFAOYSA-N |
| Density | 1.094g/cm3 (Cal.) |
|---|---|
| Boiling point | 329.405°C at 760 mmHg (Cal.) |
| Flash point | 153.019°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Ethyl-6-Methyl-2-Phenyl-4(3H)-Pyrimidinone |