|
CAS#: 33204-39-6 Product: Arteglasin A No suppilers available for the product. |
| Name | Arteglasin A |
|---|---|
| Synonyms | C09303; Oxireno(2,3)Azuleno(4,5-B)Furan-2(3H)-One, 4-(Acetyloxy)-3A,4,5,7,7A,8A,8B,8C-Octahydro-6,8A-Dimethyl-3-Methylene-, (3Ar-(3Aalpha,4Alpha,7Abeta,8Abeta,8Balpha,8Cbeta))- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 |
| CAS Registry Number | 33204-39-6 |
| SMILES | [C@@]34([C@H]1C(=C(C[C@@H]([C@@H]2[C@@H]1OC(=O)C2=C)OC(=O)C)C)C[C@H]3O4)C |
| InChI | 1S/C17H20O5/c1-7-5-11(20-9(3)18)13-8(2)16(19)21-15(13)14-10(7)6-12-17(14,4)22-12/h11-15H,2,5-6H2,1,3-4H3/t11-,12+,13+,14-,15-,17+/m0/s1 |
| InChIKey | IJNUSISHBLGZMG-JMZZHWKLSA-N |
| Density | 1.281g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.507°C at 760 mmHg (Cal.) |
| Flash point | 202.421°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Arteglasin A |