|
CAS#: 33232-85-8 Product: 1-(Ethyl-Methoxyphosphoryl)Oxy-4-Methylbenzene No suppilers available for the product. |
| Name | 1-(Ethyl-Methoxyphosphoryl)Oxy-4-Methylbenzene |
|---|---|
| Synonyms | 1-(Ethyl-Methoxy-Phosphoryl)Oxy-4-Methyl-Benzene; Phosphonic Acid, Ethyl-, Methyl P-Methylphenyl Ester; Phosphonic Acid, Ethyl-, Methyl P-Tolyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H15O3P |
| Molecular Weight | 214.20 |
| CAS Registry Number | 33232-85-8 |
| SMILES | C1=CC(=CC=C1O[P](CC)(=O)OC)C |
| InChI | 1S/C10H15O3P/c1-4-14(11,12-3)13-10-7-5-9(2)6-8-10/h5-8H,4H2,1-3H3 |
| InChIKey | CASOOGVFSAQCQG-UHFFFAOYSA-N |
| Density | 1.109g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.338°C at 760 mmHg (Cal.) |
| Flash point | 143.312°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Ethyl-Methoxyphosphoryl)Oxy-4-Methylbenzene |