|
CAS#: 3324-63-8 Product: 3-(alpha-Acetonylbenzyl)-4-hydroxycoumarin compd. with 2-(dimethylamino)ethanol (1:1) No suppilers available for the product. |
| Name | 3-(alpha-Acetonylbenzyl)-4-hydroxycoumarin compd. with 2-(dimethylamino)ethanol (1:1) |
|---|---|
| Synonyms | 2-Dimethylaminoethanol; 2-Hydroxy-3-(3-Oxo-1-Phenyl-Butyl)Chromen-4-One; 2-Dimethylaminoethanol; 2-Hydroxy-3-(3-Oxo-1-Phenylbutyl)-4-Chromenone; 2-Dimethylaminoethanol; 2-Hydroxy-3-(3-Keto-1-Phenyl-Butyl)Chromone |
| Molecular Structure | ![]() |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 |
| CAS Registry Number | 3324-63-8 |
| SMILES | C3=C(C(C2=C(OC1=CC=CC=C1C2=O)O)CC(=O)C)C=CC=C3.C(N(C)C)CO |
| InChI | 1S/C19H16O4.C4H11NO/c1-12(20)11-15(13-7-3-2-4-8-13)17-18(21)14-9-5-6-10-16(14)23-19(17)22;1-5(2)3-4-6/h2-10,15,22H,11H2,1H3;6H,3-4H2,1-2H3 |
| InChIKey | HBEIHHQIBZFANH-UHFFFAOYSA-N |
| Boiling point | 471.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 170.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(alpha-Acetonylbenzyl)-4-hydroxycoumarin compd. with 2-(dimethylamino)ethanol (1:1) |