|
CAS#: 33269-57-7 Product: Iron(2+) 1,1'-(Sulfanediyldi-1,1-Ethanediyl)Bis-2,4-Cyclopentadienide No suppilers available for the product. |
| Name | Iron(2+) 1,1'-(Sulfanediyldi-1,1-Ethanediyl)Bis-2,4-Cyclopentadienide |
|---|---|
| Synonyms | 1,1'-(Thiodiethylidene)ferrocne; EX 10-478 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16FeS |
| Molecular Weight | 272.19 |
| CAS Registry Number | 33269-57-7 |
| SMILES | [Fe+2].S(C([c-]1cccc1)C)C([c-]2cccc2)C |
| InChI | 1S/C14H16S.Fe/c1-11(13-7-3-4-8-13)15-12(2)14-9-5-6-10-14;/h3-12H,1-2H3;/q-2;+2 |
| InChIKey | BAWCBYSSERFTKX-UHFFFAOYSA-N |
| Boiling point | 320.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 139.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Iron(2+) 1,1'-(Sulfanediyldi-1,1-Ethanediyl)Bis-2,4-Cyclopentadienide |