|
CAS#: 33284-45-6 Product: 1,1,1-Trifluoro-5-Methylheptane-2,4-Dione No suppilers available for the product. |
| Name | 1,1,1-Trifluoro-5-Methylheptane-2,4-Dione |
|---|---|
| Synonyms | 1,1,1-Trifluoro-5-Methyl-Heptane-2,4-Dione; Trifluoroacetyl-.Alpha.-Methylbutyrylmethane |
| Molecular Structure | ![]() |
| Molecular Formula | C8H11F3O2 |
| Molecular Weight | 196.17 |
| CAS Registry Number | 33284-45-6 |
| EINECS | 251-441-2 |
| SMILES | C(C(C(F)(F)F)=O)C(=O)C(C)CC |
| InChI | 1S/C8H11F3O2/c1-3-5(2)6(12)4-7(13)8(9,10)11/h5H,3-4H2,1-2H3 |
| InChIKey | XQIBVFWBYJDHQQ-UHFFFAOYSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 183.575°C at 760 mmHg (Cal.) |
| Flash point | 57.35°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1-Trifluoro-5-Methylheptane-2,4-Dione |