|
CAS#: 33342-95-9 Product: Phenyl{2-[(Trimethylsilyl)Oxy]Phenyl}Methanone No suppilers available for the product. |
| Name | Phenyl{2-[(Trimethylsilyl)Oxy]Phenyl}Methanone |
|---|---|
| Synonyms | Phenyl(2-[(trimethylsilyl)oxy]phenyl)methanone #; Trimethylsilyl ether of o-hydroxybenzophenone |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18O2Si |
| Molecular Weight | 270.40 |
| CAS Registry Number | 33342-95-9 |
| SMILES | O=C(c1ccccc1O[Si](C)(C)C)c2ccccc2 |
| InChI | 1S/C16H18O2Si/c1-19(2,3)18-15-12-8-7-11-14(15)16(17)13-9-5-4-6-10-13/h4-12H,1-3H3 |
| InChIKey | GRUPJLKSIYQFEX-UHFFFAOYSA-N |
| Density | 1.039g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.776°C at 760 mmHg (Cal.) |
| Flash point | 139.42°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl{2-[(Trimethylsilyl)Oxy]Phenyl}Methanone |