|
CAS#: 33390-28-2 Product: (6-Acetyloxy-3,8-Dimethoxy-1-Methyl-7,10,12-Trioxobenzo[b]Xanthen-11-Yl) Acetate No suppilers available for the product. |
| Name | (6-Acetyloxy-3,8-Dimethoxy-1-Methyl-7,10,12-Trioxobenzo[b]Xanthen-11-Yl) Acetate |
|---|---|
| Synonyms | (6-Acetoxy-3,8-Dimethoxy-1-Methyl-7,10,12-Trioxo-Benzo[B]Xanthen-11-Yl) Acetate; Acetic Acid (6-Acetoxy-3,8-Dimethoxy-1-Methyl-7,10,12-Trioxo-11-Benzo[B]Xanthenyl) Ester; Acetic Acid (6-Acetoxy-7,10,12-Triketo-3,8-Dimethoxy-1-Methyl-Benzo[B]Xanthen-11-Yl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C24H18O10 |
| Molecular Weight | 466.40 |
| CAS Registry Number | 33390-28-2 |
| SMILES | C1=C(OC)C=C(C4=C1OC2=C(C(=C3C(=C2OC(=O)C)C(=O)C(=CC3=O)OC)OC(=O)C)C4=O)C |
| InChI | 1S/C24H18O10/c1-9-6-12(30-4)7-14-16(9)21(29)19-22(32-10(2)25)17-13(27)8-15(31-5)20(28)18(17)23(24(19)34-14)33-11(3)26/h6-8H,1-5H3 |
| InChIKey | VPMKLJDGHWQNDH-UHFFFAOYSA-N |
| Density | 1.493g/cm3 (Cal.) |
|---|---|
| Boiling point | 704.685°C at 760 mmHg (Cal.) |
| Flash point | 303.462°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (6-Acetyloxy-3,8-Dimethoxy-1-Methyl-7,10,12-Trioxobenzo[b]Xanthen-11-Yl) Acetate |