|
CAS#: 33407-62-4 Product: 2,2,7,7-Tetramethyltricyclo(6.2.1.0(1,6))-Undecan-5-One No suppilers available for the product. |
| Name | 2,2,7,7-Tetramethyltricyclo(6.2.1.0(1,6))-Undecan-5-One |
|---|---|
| Synonyms | 2H-2,4A-Methanonaphthalen-8(5H)-One, 1,3,4,6,7,8A-Hexahydro-1,1,5,5-Tetramethyl-; 2H-2,4A-Methanonaphthalen-8(5H)-One, Hexahydro-1,1,5,5-Tetramethyl-, (2Alpha,4Aalpha,8Abeta)- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| CAS Registry Number | 33407-62-4 |
| EINECS | 245-890-3 |
| SMILES | CC1(CCC(C2C13CCC(C2(C)C)C3)=O)C |
| InChI | 1S/C15H24O/c1-13(2)7-6-11(16)12-14(3,4)10-5-8-15(12,13)9-10/h10,12H,5-9H2,1-4H3 |
| InChIKey | VCOCESNMLNDPLX-UHFFFAOYSA-N |
| Density | 1.005g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.752°C at 760 mmHg (Cal.) |
| Flash point | 119.694°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,7,7-Tetramethyltricyclo(6.2.1.0(1,6))-Undecan-5-One |