|
CAS#: 334971-36-7 Product: Methyl 3-(2,6-Difluorophenyl)-5-Methyl-1,2-Oxazole-4-Carboxylate No suppilers available for the product. |
| Name | Methyl 3-(2,6-Difluorophenyl)-5-Methyl-1,2-Oxazole-4-Carboxylate |
|---|---|
| Synonyms | 4-methoxycarbonyl-5-methyl-3-(2,6-difluorophenyl)isoxazole |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9F2NO3 |
| Molecular Weight | 253.20 |
| CAS Registry Number | 334971-36-7 |
| SMILES | COC(=O)c2c(C)onc2c1c(F)cccc1F |
| InChI | 1S/C12H9F2NO3/c1-6-9(12(16)17-2)11(15-18-6)10-7(13)4-3-5-8(10)14/h3-5H,1-2H3 |
| InChIKey | GDXXZGNNVCLIBP-UHFFFAOYSA-N |
| Density | 1.31g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.642°C at 760 mmHg (Cal.) |
| Flash point | 159.21°C (Cal.) |
| Refractive index | 1.51 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3-(2,6-Difluorophenyl)-5-Methyl-1,2-Oxazole-4-Carboxylate |