Online Database of Chemicals from Around the World
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (650) 278-9963 | |||
 |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 9-Methyl-10-Phenylphenanthrene |
|---|---|
| Synonyms | 9-Methyl-10-Phenyl-Phenanthrene; Nsc340037; Phenanthrene, 9-Methyl-10-Phenyl |
| Molecular Structure |  |
| Molecular Formula | C21H16 |
| Molecular Weight | 268.36 |
| CAS Registry Number | 33498-62-3 |
| SMILES | C3=C2C(=C(C1=CC=CC=C1C2=CC=C3)C)C4=CC=CC=C4 |
| InChI | 1S/C21H16/c1-15-17-11-5-6-12-18(17)19-13-7-8-14-20(19)21(15)16-9-3-2-4-10-16/h2-14H,1H3 |
| InChIKey | VASMZEZNNVGPBU-UHFFFAOYSA-N |
| Density | 1.122g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.452°C at 760 mmHg (Cal.) |
| Flash point | 198.191°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Methyl-10-Phenylphenanthrene |