Online Database of Chemicals from Around the World
| Name | 2,2,3,3,4,4,5,5,6-Nonafluoro-6-(1,1,2,2,3,3,3-Heptafluoropropyl)Oxane |
|---|---|
| Synonyms | 2,2,3,3,4,4,5,5,6-Nonafluoro-6-(1,1,2,2,3,3,3-Heptafluoropropyl)Tetrahydropyran; 2,2,3,3,4,4,5,5,6-Nonafluoro-6-(Heptafluoropropyl)Tetrahydro-2H-Pyran |
| Molecular Structure |  |
| Molecular Formula | C8F16O |
| Molecular Weight | 416.06 |
| CAS Registry Number | 335-35-3 |
| EINECS | 206-387-4 |
| SMILES | O1C(C(C(C(C1(F)F)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)F |
| InChI | 1S/C8F16O/c9-1(10)2(11,12)6(19,25-8(23,24)5(1,17)18)3(13,14)4(15,16)7(20,21)22 |
| InChIKey | KEDSBJOHAWJRQU-UHFFFAOYSA-N |
| Density | 1.781g/cm3 (Cal.) |
|---|---|
| Boiling point | 97.804°C at 760 mmHg (Cal.) |
| Flash point | 18.328°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,3,3,4,4,5,5,6-Nonafluoro-6-(1,1,2,2,3,3,3-Heptafluoropropyl)Oxane |
