|
CAS#: 3352-93-0 Product: 2-Cyclohexen-1-Yl Benzoate No suppilers available for the product. |
| Name | 2-Cyclohexen-1-Yl Benzoate |
|---|---|
| Synonyms | 2-Cyclohexen-1-yl benzoate # |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 |
| CAS Registry Number | 3352-93-0 |
| SMILES | O=C(OC1\C=C/CCC1)c2ccccc2 |
| InChI | 1S/C13H14O2/c14-13(11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1,3-5,7-9,12H,2,6,10H2 |
| InChIKey | APZIYLKXAJJSIZ-UHFFFAOYSA-N |
| Density | 1.101g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.044°C at 760 mmHg (Cal.) |
| Flash point | 132.53°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Cyclohexen-1-Yl Benzoate |