|
CAS#: 33524-67-3 Product: 3,4,5,6-Tetra(Phenyl)Pyran-2-One No suppilers available for the product. |
| Name | 3,4,5,6-Tetra(Phenyl)Pyran-2-One |
|---|---|
| Synonyms | 3,4,5,6-Tetra(Phenyl)-2-Pyranone; 2H-Pyran-2-One, 3,4,5,6-Tetraphenyl-; 3,4,5,6-Tetraphenyl-2H-Pyran-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C29H20O2 |
| Molecular Weight | 400.48 |
| CAS Registry Number | 33524-67-3 |
| SMILES | C5=C(C2=C(C1=CC=CC=C1)OC(C(=C2C3=CC=CC=C3)C4=CC=CC=C4)=O)C=CC=C5 |
| InChI | 1S/C29H20O2/c30-29-27(23-17-9-3-10-18-23)25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)28(31-29)24-19-11-4-12-20-24/h1-20H |
| InChIKey | QGLAPFHTDCRVOR-UHFFFAOYSA-N |
| Density | 1.216g/cm3 (Cal.) |
|---|---|
| Boiling point | 620.845°C at 760 mmHg (Cal.) |
| Flash point | 260.106°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3,4,5,6-Tetra(Phenyl)Pyran-2-One |