|
CAS#: 33545-33-4 Product: Methyl 2,2-Bis(4-Methylphenyl)-5-Oxo-2,5-Dihydro-3-Furancarboxylate No suppilers available for the product. |
| Name | Methyl 2,2-Bis(4-Methylphenyl)-5-Oxo-2,5-Dihydro-3-Furancarboxylate |
|---|---|
| Synonyms | Methyl 2, |
| Molecular Structure | ![]() |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.35 |
| CAS Registry Number | 33545-33-4 |
| SMILES | O=C(OC)\C2=C\C(=O)OC2(c1ccc(cc1)C)c3ccc(cc3)C |
| InChI | 1S/C20H18O4/c1-13-4-8-15(9-5-13)20(16-10-6-14(2)7-11-16)17(19(22)23-3)12-18(21)24-20/h4-12H,1-3H3 |
| InChIKey | LNNDLZYJBUUKEI-UHFFFAOYSA-N |
| Density | 1.219g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.598°C at 760 mmHg (Cal.) |
| Flash point | 250.521°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2,2-Bis(4-Methylphenyl)-5-Oxo-2,5-Dihydro-3-Furancarboxylate |