|
CAS#: 33617-38-8 Product: 2,4-Bis[(Trimethylsilyl)Oxy]Benzaldehyde No suppilers available for the product. |
| Name | 2,4-Bis[(Trimethylsilyl)Oxy]Benzaldehyde |
|---|---|
| Synonyms | 2,4-Bis[(trimethylsilyl)oxy]benzaldehyde # |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22O3Si2 |
| Molecular Weight | 282.48 |
| CAS Registry Number | 33617-38-8 |
| SMILES | O=Cc1ccc(O[Si](C)(C)C)cc1O[Si](C)(C)C |
| InChI | 1S/C13H22O3Si2/c1-17(2,3)15-12-8-7-11(10-14)13(9-12)16-18(4,5)6/h7-10H,1-6H3 |
| InChIKey | UIOLBHGUVXPTDV-UHFFFAOYSA-N |
| Density | 0.986g/cm3 (Cal.) |
|---|---|
| Boiling point | 293.559°C at 760 mmHg (Cal.) |
| Flash point | 109.198°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Bis[(Trimethylsilyl)Oxy]Benzaldehyde |