|
CAS#: 33631-48-0 Product: (2Z,4E,6Z,8E)-3,7-Dimethyl-N-Phenyl-9-(2,6,6-Trimethyl-1-Cyclohexenyl)Nona-2,4,6,8-Tetraenamide No suppilers available for the product. |
| Name | (2Z,4E,6Z,8E)-3,7-Dimethyl-N-Phenyl-9-(2,6,6-Trimethyl-1-Cyclohexenyl)Nona-2,4,6,8-Tetraenamide |
|---|---|
| Synonyms | Ccris 4285; N-(Phenyl)Retinamide; N-Phenylretinamide |
| Molecular Structure | ![]() |
| Molecular Formula | C26H33NO |
| Molecular Weight | 375.55 |
| CAS Registry Number | 33631-48-0 |
| SMILES | C1=CC=CC=C1NC(\C=C(C)/C=C/C=C(C)\C=C\C2=C(C)CCCC2(C)C)=O |
| InChI | 1S/C26H33NO/c1-20(16-17-24-22(3)13-10-18-26(24,4)5)11-9-12-21(2)19-25(28)27-23-14-7-6-8-15-23/h6-9,11-12,14-17,19H,10,13,18H2,1-5H3,(H,27,28)/b12-9+,17-16+,20-11-,21-19- |
| InChIKey | LPUUIKWNIXVQAO-QMZPHRKVSA-N |
| Density | 1.033g/cm3 (Cal.) |
|---|---|
| Boiling point | 557.25°C at 760 mmHg (Cal.) |
| Flash point | 342.423°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2Z,4E,6Z,8E)-3,7-Dimethyl-N-Phenyl-9-(2,6,6-Trimethyl-1-Cyclohexenyl)Nona-2,4,6,8-Tetraenamide |