|
CAS#: 33664-93-6 Product: 5,5-Dimethyl-4-Phenyl-1,3-Oxazolidin-2-One No suppilers available for the product. |
| Name | 5,5-Dimethyl-4-Phenyl-1,3-Oxazolidin-2-One |
|---|---|
| Synonyms | 5,5-Dimethyl-4-Phenyl-Oxazolidin-2-One; 5,5-Dimethyl-4-Phenyl-2-Oxazolidinone; Nsc275427 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 |
| CAS Registry Number | 33664-93-6 |
| SMILES | C2=C(C1C(OC(N1)=O)(C)C)C=CC=C2 |
| InChI | 1S/C11H13NO2/c1-11(2)9(12-10(13)14-11)8-6-4-3-5-7-8/h3-7,9H,1-2H3,(H,12,13) |
| InChIKey | HSQRCAULDOQKPF-UHFFFAOYSA-N |
| Density | 1.093g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.212°C at 760 mmHg (Cal.) |
| Flash point | 185.56°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,5-Dimethyl-4-Phenyl-1,3-Oxazolidin-2-One |