|
CAS#: 33712-72-0 Product: Tris(2-Chloropropoxy)-Sulfanylidenephosphorane No suppilers available for the product. |
| Name | Tris(2-Chloropropoxy)-Sulfanylidenephosphorane |
|---|---|
| Synonyms | Tris(2-Chloropropoxy)-Thioxo-Phosphorane; Tris(2-Chloropropoxy)-Thioxophosphorane; Tris(2-Chloropropoxy)-Sulfanylidene-Phosphorane |
| Molecular Structure | ![]() |
| Molecular Formula | C9H18Cl3O3PS |
| Molecular Weight | 343.63 |
| CAS Registry Number | 33712-72-0 |
| EINECS | 251-651-4 |
| SMILES | C(O[P](=S)(OCC(Cl)C)OCC(Cl)C)C(Cl)C |
| InChI | 1S/C9H18Cl3O3PS/c1-7(10)4-13-16(17,14-5-8(2)11)15-6-9(3)12/h7-9H,4-6H2,1-3H3 |
| InChIKey | WWKDGLRDWDSGLU-UHFFFAOYSA-N |
| Density | 1.304g/cm3 (Cal.) |
|---|---|
| Boiling point | 357.531°C at 760 mmHg (Cal.) |
| Flash point | 170.029°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tris(2-Chloropropoxy)-Sulfanylidenephosphorane |