|
CAS#: 33732-68-2 Product: 4-Chloro-1-Phenylbicyclo[2.2.2]Octane No suppilers available for the product. |
| Name | 4-Chloro-1-Phenylbicyclo[2.2.2]Octane |
|---|---|
| Synonyms | 4-Chloro-1-Phenyl-Bicyclo[2.2.2]Octane; 1-Chloro-4-Phenylbicyclo[2.2.2]Octane; Bicyclo[2.2.2]Octane, 1-Chloro-4-Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17Cl |
| Molecular Weight | 220.74 |
| CAS Registry Number | 33732-68-2 |
| SMILES | C1=CC=CC=C1C23CCC(Cl)(CC2)CC3 |
| InChI | 1S/C14H17Cl/c15-14-9-6-13(7-10-14,8-11-14)12-4-2-1-3-5-12/h1-5H,6-11H2 |
| InChIKey | ZHWPZWVGLRJGPD-UHFFFAOYSA-N |
| Density | 1.125g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.151°C at 760 mmHg (Cal.) |
| Flash point | 132.257°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-1-Phenylbicyclo[2.2.2]Octane |