|
CAS#: 33781-73-6 Product: 1,3-Bis(2,2-Dimethylpropyl)-2,4,5,6-Tetramethylbenzene No suppilers available for the product. |
| Name | 1,3-Bis(2,2-Dimethylpropyl)-2,4,5,6-Tetramethylbenzene |
|---|---|
| Synonyms | 1,3-Bis(2,2-Dimethylpropyl)-2,4,5,6-Tetramethyl-Benzene; 1,2,3,5-Tetramethyl-4,6-Dineopentyl-Benzene; 1,2,3,5-Tetramethyl-4,6-Di(2,2-Dimethylpropyl)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 |
| CAS Registry Number | 33781-73-6 |
| SMILES | C(C1=C(C(=C(C(=C1C)C)C)CC(C)(C)C)C)C(C)(C)C |
| InChI | 1S/C20H34/c1-13-14(2)17(11-19(5,6)7)16(4)18(15(13)3)12-20(8,9)10/h11-12H2,1-10H3 |
| InChIKey | NSSMYFQUYITACG-UHFFFAOYSA-N |
| Density | 0.86g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.494°C at 760 mmHg (Cal.) |
| Flash point | 169.837°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Bis(2,2-Dimethylpropyl)-2,4,5,6-Tetramethylbenzene |