|
CAS#: 33798-77-5 Product: Ethyl 2-{[(4-Methylphenyl)Sulfonyl]Oxy}Propanoate No suppilers available for the product. |
| Name | Ethyl 2-{[(4-Methylphenyl)Sulfonyl]Oxy}Propanoate |
|---|---|
| Synonyms | 2-(Toluene-4-sulfonyloxy)propionic acid, ethyl ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O5S |
| Molecular Weight | 272.32 |
| CAS Registry Number | 33798-77-5 |
| SMILES | O=C(OCC)C(OS(=O)(=O)c1ccc(cc1)C)C |
| InChI | 1S/C12H16O5S/c1-4-16-12(13)10(3)17-18(14,15)11-7-5-9(2)6-8-11/h5-8,10H,4H2,1-3H3 |
| InChIKey | SNLMUZGICZJWKN-UHFFFAOYSA-N |
| Density | 1.217g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.321°C at 760 mmHg (Cal.) |
| Flash point | 186.231°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-{[(4-Methylphenyl)Sulfonyl]Oxy}Propanoate |