Online Database of Chemicals from Around the World
|
CAS#: 3380-44-7 Product: 4,5-Dichloro-2-(2,4-Dichlorophenoxy)Phenol No suppilers available for the product. |
| Name | 4,5-Dichloro-2-(2,4-Dichlorophenoxy)Phenol |
|---|---|
| Synonyms | Phenol, 4,5-Dichloro-2-(2,4-Dichlorophenoxy)-; 2',4,4',5-Tetrachloro-2-Hydroxydiphenyl Ether; Brn 2058686 |
| Molecular Structure |  |
| Molecular Formula | C12H6Cl4O2 |
| Molecular Weight | 323.99 |
| CAS Registry Number | 3380-44-7 |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)O)OC2=CC=C(C=C2Cl)Cl |
| InChI | 1S/C12H6Cl4O2/c13-6-1-2-11(9(16)3-6)18-12-5-8(15)7(14)4-10(12)17/h1-5,17H |
| InChIKey | MCNUFYGRHZLQGD-UHFFFAOYSA-N |
| Density | 1.571g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.105°C at 760 mmHg (Cal.) |
| Flash point | 180.052°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Dichloro-2-(2,4-Dichlorophenoxy)Phenol |