| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054//+86 13424336463 | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | 5-Methyl-N4-(1,3-Thiazol-2-Yl)-1,2-Oxazole-3,4-Dicarboxamide |
|---|---|
| Synonyms | 5-methyl-N4-(1,3-thiazol- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8N4O3S |
| Molecular Weight | 252.25 |
| CAS Registry Number | 338408-95-0 |
| SMILES | CC1=C(C(=NO1)C(=O)N)C(=O)NC2=NC=CS2 |
| InChI | 1S/C9H8N4O3S/c1-4-5(6(7(10)14)13-16-4)8(15)12-9-11-2-3-17-9/h2-3H,1H3,(H2,10,14)(H,11,12,15) |
| InChIKey | OXSKIHCDHQSZBA-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 297-299°C (Expl.) |
| Refractive index | 1.683 (Cal.) |
| (1) | Chen, Y and Shoichet BK. Molecular docking and ligand specificity in fragment-based inhibitor design, Nature Chemical Biology, 2009 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-N4-(1,3-Thiazol-2-Yl)-1,2-Oxazole-3,4-Dicarboxamide |