|
CAS#: 33852-25-4 Product: 7,8,9,10,10a,11-Hexahydro-2,3-Dimethoxy-13H-Pyrido(1',2':3,4)Imidazo(2,1-b)Quinazolin-13-One No suppilers available for the product. |
| Name | 7,8,9,10,10a,11-Hexahydro-2,3-Dimethoxy-13H-Pyrido(1',2':3,4)Imidazo(2,1-b)Quinazolin-13-One |
|---|---|
| Synonyms | 2,3-Dimethoxy-7,8,9,10,10A,11-Hexahydro-13H-Pyrido(1',2':3,4)Imidazo(2,1-B)Quinazolin-13-One; Brn 0896213 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.34 |
| CAS Registry Number | 33852-25-4 |
| SMILES | C1=C(C(=CC2=C1C(N3C(=N2)N4C(C3)CCCC4)=O)OC)OC |
| InChI | 1S/C16H19N3O3/c1-21-13-7-11-12(8-14(13)22-2)17-16-18-6-4-3-5-10(18)9-19(16)15(11)20/h7-8,10H,3-6,9H2,1-2H3 |
| InChIKey | UUQZDQWAJRVIOF-UHFFFAOYSA-N |
| Density | 1.428g/cm3 (Cal.) |
|---|---|
| Boiling point | 480.597°C at 760 mmHg (Cal.) |
| Flash point | 244.457°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,8,9,10,10a,11-Hexahydro-2,3-Dimethoxy-13H-Pyrido(1',2':3,4)Imidazo(2,1-b)Quinazolin-13-One |