|
CAS#: 3389-36-4 Product: 6-(Ethylsulfanylmethyl)-7H-Purine No suppilers available for the product. |
| Name | 6-(Ethylsulfanylmethyl)-7H-Purine |
|---|---|
| Synonyms | 6-[(Ethylthio)Methyl]-7H-Purine; Nsc529189 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10N4S |
| Molecular Weight | 194.25 |
| CAS Registry Number | 3389-36-4 |
| SMILES | C2=NC1=C(C(=NC=N1)CSCC)[NH]2 |
| InChI | 1S/C8H10N4S/c1-2-13-3-6-7-8(11-4-9-6)12-5-10-7/h4-5H,2-3H2,1H3,(H,9,10,11,12) |
| InChIKey | RHVIEWNPXGDCMD-UHFFFAOYSA-N |
| Density | 1.341g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.693°C at 760 mmHg (Cal.) |
| Flash point | 226.371°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(Ethylsulfanylmethyl)-7H-Purine |