|
CAS#: 33916-25-5 Product: 4,8'-Dihydroxy-2,6'-Dimethyl-1,2'-Binaphthalene-1',4',5,8-Tetrone No suppilers available for the product. |
| Name | 4,8'-Dihydroxy-2,6'-Dimethyl-1,2'-Binaphthalene-1',4',5,8-Tetrone |
|---|---|
| Synonyms | 4,8'-dihy |
| Molecular Structure | ![]() |
| Molecular Formula | C22H14O6 |
| Molecular Weight | 374.34 |
| CAS Registry Number | 33916-25-5 |
| SMILES | CC1=CC2=C(C(=C1)O)C(=O)C(=CC2=O)C3=C4C(=O)C=CC(=O)C4=C(C=C3C)O |
| InChI | 1S/C22H14O6/c1-9-5-11-15(25)8-12(22(28)19(11)16(26)6-9)18-10(2)7-17(27)20-13(23)3-4-14(24)21(18)20/h3-8,26-27H,1-2H3 |
| InChIKey | LZAXNDGRDVWTFX-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 732.3±60.0°C at 760 mmHg (Cal.) |
| Flash point | 410.6±29.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,8'-Dihydroxy-2,6'-Dimethyl-1,2'-Binaphthalene-1',4',5,8-Tetrone |