|
CAS#: 33986-33-3 Product: 2,3,6-Trichloro-N-Phenylbenzamide No suppilers available for the product. |
| Name | 2,3,6-Trichloro-N-Phenylbenzamide |
|---|---|
| Synonyms | 2,3,6-Trichloro-N-Phenyl-Benzamide; Nsc80077; Oprea1_605082 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H8Cl3NO |
| Molecular Weight | 300.57 |
| CAS Registry Number | 33986-33-3 |
| SMILES | C1=CC(=C(Cl)C(=C1Cl)C(=O)NC2=CC=CC=C2)Cl |
| InChI | 1S/C13H8Cl3NO/c14-9-6-7-10(15)12(16)11(9)13(18)17-8-4-2-1-3-5-8/h1-7H,(H,17,18) |
| InChIKey | JDXGOODVENRQEN-UHFFFAOYSA-N |
| Density | 1.472g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.911°C at 760 mmHg (Cal.) |
| Flash point | 173.282°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,6-Trichloro-N-Phenylbenzamide |