Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Phenyl(3-Chloropropyl)Dichlorosilane |
|---|---|
| Synonyms | Dichloro-(3-Chloropropyl)-Phenyl-Silane; Dichloro(3-Chloropropyl)Phenylsilane |
| Molecular Structure |  |
| Molecular Formula | C9H11Cl3Si |
| Molecular Weight | 253.63 |
| CAS Registry Number | 3401-26-1 |
| EINECS | 222-271-6 |
| SMILES | C1=C([Si](CCCCl)(Cl)Cl)C=CC=C1 |
| InChI | 1S/C9H11Cl3Si/c10-7-4-8-13(11,12)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
| InChIKey | UWHAIVBRBAKZDT-UHFFFAOYSA-N |
| Density | 1.209g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.999°C at 760 mmHg (Cal.) |
| Flash point | 140.539°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl(3-Chloropropyl)Dichlorosilane |