|
CAS#: 3403-23-4 Product: Di(Phenyl)Methyl N-Aminocarbamate No suppilers available for the product. |
| Name | Di(Phenyl)Methyl N-Aminocarbamate |
|---|---|
| Synonyms | N-Aminocarbamic Acid Di(Phenyl)Methyl Ester; Carbazic Acid, Diphenylmethyl Ester (8Ci); Carbazic Acid, Diphenylmethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 |
| CAS Registry Number | 3403-23-4 |
| SMILES | C2=C(C(C1=CC=CC=C1)OC(NN)=O)C=CC=C2 |
| InChI | 1S/C14H14N2O2/c15-16-14(17)18-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,15H2,(H,16,17) |
| InChIKey | LKGRPUNUHDQTJB-UHFFFAOYSA-N |
| Density | 1.199g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.919°C at 760 mmHg (Cal.) |
| Flash point | 220.46°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Di(Phenyl)Methyl N-Aminocarbamate |