|
CAS#: 3414-84-4 Product: 6-Methylenedihydroepoxymorphine No suppilers available for the product. |
| Name | 6-Methylenedihydroepoxymorphine |
|---|---|
| Synonyms | 6-Methylenedihydrodesoxymorphine; 6-Methylenedihydroepoxymorphine; Brn 0039900 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 |
| CAS Registry Number | 3414-84-4 |
| SMILES | [C@@H]15CC4=C3[C@@]2([C@H]1CCC(=C)[C@@H]2OC3=C(C=C4)O)CCN5C |
| InChI | 1S/C18H21NO2/c1-10-3-5-12-13-9-11-4-6-14(20)16-15(11)18(12,17(10)21-16)7-8-19(13)2/h4,6,12-13,17,20H,1,3,5,7-9H2,2H3/t12-,13+,17-,18-/m0/s1 |
| InChIKey | LBCZKDPFDXFDTN-GGNLRSJOSA-N |
| Density | 1.302g/cm3 (Cal.) |
|---|---|
| Boiling point | 423.938°C at 760 mmHg (Cal.) |
| Flash point | 210.19°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methylenedihydroepoxymorphine |