|
CAS#: 34175-98-9 Product: 6-(2-Chloroethyl)-2,5,7-Trimethyl-2,3-Dihydroinden-1-One No suppilers available for the product. |
| Name | 6-(2-Chloroethyl)-2,5,7-Trimethyl-2,3-Dihydroinden-1-One |
|---|---|
| Synonyms | 6-(2-Chloroethyl)-2,5,7-Trimethyl-Indan-1-One; 6-(2-Chloroethyl)-2,5,7-Trimethyl-1-Indanone; Hj-5 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17ClO |
| Molecular Weight | 236.74 |
| CAS Registry Number | 34175-98-9 |
| SMILES | C1=C2C(=C(C(=C1C)CCCl)C)C(C(C)C2)=O |
| InChI | 1S/C14H17ClO/c1-8-6-11-7-9(2)14(16)13(11)10(3)12(8)4-5-15/h6,9H,4-5,7H2,1-3H3 |
| InChIKey | DFJCTWMNTSWCRI-UHFFFAOYSA-N |
| Density | 1.118g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.369°C at 760 mmHg (Cal.) |
| Flash point | 214.384°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(2-Chloroethyl)-2,5,7-Trimethyl-2,3-Dihydroinden-1-One |