|
CAS#: 34262-88-9 Product: Cobalt terephthalate No suppilers available for the product. |
| Name | Cobalt terephthalate |
|---|---|
| Synonyms | Cobaltous Terephthalate; 1,4-Benzenedicarboxylic Acid, Cobalt Salt; Cobalt Terephthalate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H4CoO4 |
| Molecular Weight | 223.05 |
| CAS Registry Number | 34262-88-9 |
| EINECS | 251-901-2 |
| SMILES | C1=C(C=CC(=C1)C([O-])=O)C([O-])=O.[Co++] |
| InChI | 1S/C8H6O4.Co/c9-7(10)5-1-2-6(4-3-5)8(11)12;/h1-4H,(H,9,10)(H,11,12);/q;+2/p-2 |
| InChIKey | OEGQYSCBJGUGEN-UHFFFAOYSA-L |
| Boiling point | 392.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 205.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cobalt terephthalate |