|
CAS#: 342899-40-5 Product: N-(3-Chloro-4-Isoquinolinyl)-2-(Cyclopropylamino)Nicotinamide No suppilers available for the product. |
| Name | N-(3-Chloro-4-Isoquinolinyl)-2-(Cyclopropylamino)Nicotinamide |
|---|---|
| Synonyms | 3-PYRIDIN |
| Molecular Structure | ![]() |
| Molecular Formula | C18H15ClN4O |
| Molecular Weight | 338.79 |
| CAS Registry Number | 342899-40-5 |
| SMILES | O=C(c2cccnc2NC1CC1)Nc4c3c(cccc3)cnc4Cl |
| InChI | 1S/C18H15ClN4O/c19-16-15(13-5-2-1-4-11(13)10-21-16)23-18(24)14-6-3-9-20-17(14)22-12-7-8-12/h1-6,9-10,12H,7-8H2,(H,20,22)(H,23,24) |
| InChIKey | NNTZVIHITIBXIB-UHFFFAOYSA-N |
| Density | 1.476g/cm3 (Cal.) |
|---|---|
| Boiling point | 501.707°C at 760 mmHg (Cal.) |
| Flash point | 257.223°C (Cal.) |
| Refractive index | 1.783 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(3-Chloro-4-Isoquinolinyl)-2-(Cyclopropylamino)Nicotinamide |