|
CAS#: 34297-28-4 Product: (2R)-2-Amino-3-Methyl-3-Methylsulfanylbutanoic Acid No suppilers available for the product. |
| Name | (2R)-2-Amino-3-Methyl-3-Methylsulfanylbutanoic Acid |
|---|---|
| Synonyms | (2R)-2-Amino-3-Methyl-3-Methylsulfanyl-Butanoic Acid; (2R)-2-Amino-3-Methyl-3-(Methylthio)Butanoic Acid; (2R)-2-Amino-3-Methyl-3-(Methylthio)Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13NO2S |
| Molecular Weight | 163.23 |
| CAS Registry Number | 34297-28-4 |
| SMILES | [C@H](C(=O)O)(N)C(C)(C)SC |
| InChI | 1S/C6H13NO2S/c1-6(2,10-3)4(7)5(8)9/h4H,7H2,1-3H3,(H,8,9)/t4-/m1/s1 |
| InChIKey | XSMLYGQTOGLZDA-SCSAIBSYSA-N |
| Density | 1.164g/cm3 (Cal.) |
|---|---|
| Boiling point | 278.546°C at 760 mmHg (Cal.) |
| Flash point | 122.26°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R)-2-Amino-3-Methyl-3-Methylsulfanylbutanoic Acid |