Online Database of Chemicals from Around the World
|
CAS#: 343-75-9 Product: N,N-Dimethyl-4-(2,4,6-Trifluorophenyl)Diazenylaniline No suppilers available for the product. |
| Name | N,N-Dimethyl-4-(2,4,6-Trifluorophenyl)Diazenylaniline |
|---|---|
| Synonyms | N,N-Dimethyl-4-(2,4,6-Trifluorophenyl)Azo-Aniline; N,N-Dimethyl-4-(2,4,6-Trifluorophenyl)Azoaniline; Dimethyl-[4-(2,4,6-Trifluorophenyl)Azophenyl]Amine |
| Molecular Structure |  |
| Molecular Formula | C14H12F3N3 |
| Molecular Weight | 279.26 |
| CAS Registry Number | 343-75-9 |
| SMILES | C1=C(C(=C(C=C1F)F)N=NC2=CC=C(C=C2)N(C)C)F |
| InChI | 1S/C14H12F3N3/c1-20(2)11-5-3-10(4-6-11)18-19-14-12(16)7-9(15)8-13(14)17/h3-8H,1-2H3 |
| InChIKey | LROMNQOLVOBBFE-UHFFFAOYSA-N |
| Density | 1.224g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.803°C at 760 mmHg (Cal.) |
| Flash point | 184.708°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-4-(2,4,6-Trifluorophenyl)Diazenylaniline |