|
CAS#: 34332-27-9 Product: 3-O-Tert-Butylmorphine No suppilers available for the product. |
| Name | 3-O-Tert-Butylmorphine |
|---|---|
| Synonyms | Morphinan-6-Ol, 7,8-Didehydro-3-(1,1-Dimethylethoxy)-4,5-Epoxy-17-Methyl-, (5Alpha,6Alpha)- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 |
| CAS Registry Number | 34332-27-9 |
| SMILES | [C@@H]15CC4=C3[C@@]2([C@H]1C=C[C@@H]([C@@H]2OC3=C(C=C4)OC(C)(C)C)O)CCN5C |
| InChI | 1S/C21H27NO3/c1-20(2,3)25-16-8-5-12-11-14-13-6-7-15(23)19-21(13,9-10-22(14)4)17(12)18(16)24-19/h5-8,13-15,19,23H,9-11H2,1-4H3/t13-,14+,15-,19-,21-/m0/s1 |
| InChIKey | KGAFKGNBYPHAJK-JIDSPLGISA-N |
| Density | 1.257g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.517°C at 760 mmHg (Cal.) |
| Flash point | 245.618°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-O-Tert-Butylmorphine |