|
CAS#: 3435-75-4 Product: 2-Fluoro-N-(2-Nitrophenyl)Acetamide No suppilers available for the product. |
| Name | 2-Fluoro-N-(2-Nitrophenyl)Acetamide |
|---|---|
| Synonyms | 2-Fluoro-N-(2-Nitrophenyl)Ethanamide; 2-Fluoro-2'-Nitroacetanilide; Acetanilide, 2-Fluoro-2'-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7FN2O3 |
| Molecular Weight | 198.15 |
| CAS Registry Number | 3435-75-4 |
| SMILES | C1=CC=CC(=C1[N+]([O-])=O)NC(=O)CF |
| InChI | 1S/C8H7FN2O3/c9-5-8(12)10-6-3-1-2-4-7(6)11(13)14/h1-4H,5H2,(H,10,12) |
| InChIKey | BUYNRSGTYSUEGG-UHFFFAOYSA-N |
| Density | 1.417g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.391°C at 760 mmHg (Cal.) |
| Flash point | 195.345°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Fluoro-N-(2-Nitrophenyl)Acetamide |