|
CAS#: 3439-15-4 Product: Dimethyl-(2-Phenylethyl)-Trimethylsilyloxysilane No suppilers available for the product. |
| Name | Dimethyl-(2-Phenylethyl)-Trimethylsilyloxysilane |
|---|---|
| Synonyms | Dimethyl-(2-Phenylethyl)-Trimethylsilyloxy-Silane; Disiloxane, Pentamethyl(2-Phenylethyl)-; Phenethylpentamethyldisiloxane |
| Molecular Structure | ![]() |
| Molecular Formula | C13H24OSi2 |
| Molecular Weight | 252.50 |
| CAS Registry Number | 3439-15-4 |
| SMILES | C1=CC=C(C=C1)CC[Si](O[Si](C)(C)C)(C)C |
| InChI | 1S/C13H24OSi2/c1-15(2,3)14-16(4,5)12-11-13-9-7-6-8-10-13/h6-10H,11-12H2,1-5H3 |
| InChIKey | STJDVFLIFYPTDX-UHFFFAOYSA-N |
| Density | 0.893g/cm3 (Cal.) |
|---|---|
| Boiling point | 249.154°C at 760 mmHg (Cal.) |
| Flash point | 88.105°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl-(2-Phenylethyl)-Trimethylsilyloxysilane |