|
CAS#: 34425-84-8 Product: Sodium 2,6-Dichloro-3,5-Dimethylphenolate No suppilers available for the product. |
| Name | Sodium 2,6-Dichloro-3,5-Dimethylphenolate |
|---|---|
| Synonyms | Sodium 2,6-Dichloro-3,5-Dimethyl-Phenolate; Sodium 2,4-Dichloro-3,5-Xylenolate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7Cl2NaO |
| Molecular Weight | 213.04 |
| CAS Registry Number | 34425-84-8 |
| EINECS | 252-012-2 |
| SMILES | C1=C(C(=C([O-])C(=C1C)Cl)Cl)C.[Na+] |
| InChI | 1S/C8H8Cl2O.Na/c1-4-3-5(2)7(10)8(11)6(4)9;/h3,11H,1-2H3;/q;+1/p-1 |
| InChIKey | NMULXDJVOJAUOY-UHFFFAOYSA-M |
| Boiling point | 247°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 109.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 2,6-Dichloro-3,5-Dimethylphenolate |