|
CAS#: 34441-47-9 Product: 1-Nitro-3-(2-Nitroethenyl)Benzene No suppilers available for the product. |
| Name | 1-Nitro-3-(2-Nitroethenyl)Benzene |
|---|---|
| Synonyms | 1-Nitro-3-[(E)-2-Nitroethenyl]Benzene; 1-Nitro-3-(2-Nitrovinyl)Benzene; 1-Nitro-3-[(E)-2-Nitrovinyl]Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6N2O4 |
| Molecular Weight | 194.15 |
| CAS Registry Number | 34441-47-9 |
| SMILES | C1=C(C=CC=C1[N+]([O-])=O)\C=C\[N+]([O-])=O |
| InChI | 1S/C8H6N2O4/c11-9(12)5-4-7-2-1-3-8(6-7)10(13)14/h1-6H/b5-4+ |
| InChIKey | YOEGXQQUPVDQEE-SNAWJCMRSA-N |
| Density | 1.402g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.63°C at 760 mmHg (Cal.) |
| Flash point | 175.435°C (Cal.) |
| Safety Description | IRRITANT |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Nitro-3-(2-Nitroethenyl)Benzene |