|
CAS#: 34491-04-8 Product: [[(E)-3-Chlorobut-2-Enoyl]Amino]Methyl Dimethyl Phosphate No suppilers available for the product. |
| Name | [[(E)-3-Chlorobut-2-Enoyl]Amino]Methyl Dimethyl Phosphate |
|---|---|
| Synonyms | Phosphoric Acid [[(E)-3-Chloro-1-Oxobut-2-Enyl]Amino]Methyl Dimethyl Ester; Phosphoric Acid [[(E)-3-Chlorobut-2-Enoyl]Amino]Methyl Dimethyl Ester; 2-Chloro-1-Methyl-3-(Methylamino)-3-Oxo-1-Propenyl Dimethyl Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H13ClNO5P |
| Molecular Weight | 257.61 |
| CAS Registry Number | 34491-04-8 |
| SMILES | C(O[P](OC)(OC)=O)NC(=O)\C=C(Cl)/C |
| InChI | 1S/C7H13ClNO5P/c1-6(8)4-7(10)9-5-14-15(11,12-2)13-3/h4H,5H2,1-3H3,(H,9,10)/b6-4+ |
| InChIKey | ISVQLTLOWMKMRM-GQCTYLIASA-N |
| Density | 1.301g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.17°C at 760 mmHg (Cal.) |
| Flash point | 182.511°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [[(E)-3-Chlorobut-2-Enoyl]Amino]Methyl Dimethyl Phosphate |