Online Database of Chemicals from Around the World
|
CAS#: 34522-40-2 Product: N,N-Dimethyl-4-(3,4,5-Trimethylphenyl)Diazenylaniline No suppilers available for the product. |
| Name | N,N-Dimethyl-4-(3,4,5-Trimethylphenyl)Diazenylaniline |
|---|---|
| Synonyms | N,N-Dimethyl-4-(3,4,5-Trimethylphenyl)Azo-Aniline; N,N-Dimethyl-4-(3,4,5-Trimethylphenyl)Azoaniline; Dimethyl-[4-(3,4,5-Trimethylphenyl)Azophenyl]Amine |
| Molecular Structure |  |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.37 |
| CAS Registry Number | 34522-40-2 |
| SMILES | C1=C(C=C(C(=C1C)C)C)N=NC2=CC=C(C=C2)N(C)C |
| InChI | 1S/C17H21N3/c1-12-10-16(11-13(2)14(12)3)19-18-15-6-8-17(9-7-15)20(4)5/h6-11H,1-5H3 |
| InChIKey | ZWJISUKJPCVYPN-UHFFFAOYSA-N |
| Density | 1.008g/cm3 (Cal.) |
|---|---|
| Boiling point | 422.558°C at 760 mmHg (Cal.) |
| Flash point | 209.356°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-4-(3,4,5-Trimethylphenyl)Diazenylaniline |