|
CAS#: 3457-97-4 Product: 1,10-Decanediyl Dinitrate No suppilers available for the product. |
| Name | 1,10-Decanediyl Dinitrate |
|---|---|
| Synonyms | 1,10-Decanediol dinitrate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H20N2O6 |
| Molecular Weight | 264.28 |
| CAS Registry Number | 3457-97-4 |
| SMILES | [O-][N+](=O)OCCCCCCCCCCO[N+]([O-])=O |
| InChI | 1S/C10H20N2O6/c13-11(14)17-9-7-5-3-1-2-4-6-8-10-18-12(15)16/h1-10H2 |
| InChIKey | UFYNVPISRBFSHO-UHFFFAOYSA-N |
| Density | 1.14g/cm3 (Cal.) |
|---|---|
| Boiling point | 346.405°C at 760 mmHg (Cal.) |
| Flash point | 133.802°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,10-Decanediyl Dinitrate |