|
CAS#: 34646-53-2 Product: 3-(2,4-Dichlorophenoxy)Propane-1,2-Diol No suppilers available for the product. |
| Name | 3-(2,4-Dichlorophenoxy)Propane-1,2-Diol |
|---|---|
| Synonyms | 4-06-00-00895 (Beilstein Handbook Reference); Ai3-13148; Brn 2454341 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10Cl2O3 |
| Molecular Weight | 237.08 |
| CAS Registry Number | 34646-53-2 |
| SMILES | C1=C(C(=CC(=C1)Cl)Cl)OCC(CO)O |
| InChI | 1S/C9H10Cl2O3/c10-6-1-2-9(8(11)3-6)14-5-7(13)4-12/h1-3,7,12-13H,4-5H2 |
| InChIKey | ZIBOAPBPXIPVLG-UHFFFAOYSA-N |
| Density | 1.43g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.414°C at 760 mmHg (Cal.) |
| Flash point | 194.149°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2,4-Dichlorophenoxy)Propane-1,2-Diol |