| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| ChemDiv, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | Benzotrifuroxan |
|---|---|
| Synonyms | Benzo(1,2-C:3,4-C':5,6-C'')Tris(1,2,5)Oxadiazole, 1,4,7-Trioxide; Brn 0051220; Btf |
| Molecular Structure | ![]() |
| Molecular Formula | C6N6O6 |
| Molecular Weight | 252.10 |
| CAS Registry Number | 3470-17-5 |
| SMILES | [O-][N+]4=C3C1=NO[N+](=C1C2=NO[N+](=C2C3=NO4)[O-])[O-] |
| InChI | 1S/C6N6O6/c13-10-4-1(7-16-10)5-3(8-17-11(5)14)6-2(4)9-18-12(6)15 |
| InChIKey | ROSQKRBIBODSRH-UHFFFAOYSA-N |
| Density | 3.45g/cm3 (Cal.) |
|---|---|
| Boiling point | 605.139°C at 760 mmHg (Cal.) |
| Flash point | 319.777°C (Cal.) |
| (1) | Giovanni Palmisano, Elisa García-López, Giuseppe Marcì, Vittorio Loddo, Sedat Yurdakal, Vincenzo Augugliaro and Leonardo Palmisano. Advances in selective conversions by heterogeneous photocatalysis, Chem. Commun., 2010, 46, 7074. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Benzotrifuroxan |