|
CAS#: 34729-62-9 Product: 2-Tert-Butyl-4-Methyl-6-(2,4,4-Trimethylpentan-2-Yl)Phenol No suppilers available for the product. |
| Name | 2-Tert-Butyl-4-Methyl-6-(2,4,4-Trimethylpentan-2-Yl)Phenol |
|---|---|
| Synonyms | 2-Tert-Butyl-4-Methyl-6-(1,1,3,3-Tetramethylbutyl)Phenol; 6-(1,1,3,3-Tetramethylbutyl)-2-Tert-Butyl-4-Cresol; Phenol, 2-(1,1-Dimethylethyl)-4-Methyl-6-(1,1,3,3-Tetramethylbutyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 |
| CAS Registry Number | 34729-62-9 |
| SMILES | C1=C(C(=C(C=C1C)C(C)(C)CC(C)(C)C)O)C(C)(C)C |
| InChI | 1S/C19H32O/c1-13-10-14(18(5,6)7)16(20)15(11-13)19(8,9)12-17(2,3)4/h10-11,20H,12H2,1-9H3 |
| InChIKey | ICDQZCSOHYBOQA-UHFFFAOYSA-N |
| Density | 0.911g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.75°C at 760 mmHg (Cal.) |
| Flash point | 146.262°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Tert-Butyl-4-Methyl-6-(2,4,4-Trimethylpentan-2-Yl)Phenol |