|
CAS#: 34801-16-6 Product: 4-(5-Nitrothiophen-2-Yl)-1,3-Thiazol-2-Amine No suppilers available for the product. |
| Name | 4-(5-Nitrothiophen-2-Yl)-1,3-Thiazol-2-Amine |
|---|---|
| Synonyms | 4-(5-Nitro-2-Thienyl)Thiazol-2-Amine; 4-(5-Nitro-2-Thienyl)-2-Thiazolamine; [4-(5-Nitro-2-Thienyl)Thiazol-2-Yl]Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C7H5N3O2S2 |
| Molecular Weight | 227.26 |
| CAS Registry Number | 34801-16-6 |
| SMILES | C2=C(C1=CC=C(S1)[N+]([O-])=O)N=C(S2)N |
| InChI | 1S/C7H5N3O2S2/c8-7-9-4(3-13-7)5-1-2-6(14-5)10(11)12/h1-3H,(H2,8,9) |
| InChIKey | YXXHXFBIUKWGMW-UHFFFAOYSA-N |
| Density | 1.612g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.62°C at 760 mmHg (Cal.) |
| Flash point | 228.746°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(5-Nitrothiophen-2-Yl)-1,3-Thiazol-2-Amine |