|
CAS#: 34995-43-2 Product: 1-(1,1-Dimethyl-6-Azaspiro[2.5]Octa-4,7-Dien-6-Yl)Ethanone No suppilers available for the product. |
| Name | 1-(1,1-Dimethyl-6-Azaspiro[2.5]Octa-4,7-Dien-6-Yl)Ethanone |
|---|---|
| Synonyms | 6-Azaspiro[2.5]Octa-4,7-Diene, 6-Acetyl-1,1-Dimethyl-; Nsc124423 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 |
| CAS Registry Number | 34995-43-2 |
| SMILES | CC(=O)N2C=CC1(CC1(C)C)C=C2 |
| InChI | 1S/C11H15NO/c1-9(13)12-6-4-11(5-7-12)8-10(11,2)3/h4-7H,8H2,1-3H3 |
| InChIKey | TXJSIDLNQPDGPD-UHFFFAOYSA-N |
| Density | 1.08g/cm3 (Cal.) |
|---|---|
| Boiling point | 287.166°C at 760 mmHg (Cal.) |
| Flash point | 126.238°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1,1-Dimethyl-6-Azaspiro[2.5]Octa-4,7-Dien-6-Yl)Ethanone |